3-(Boc-aminomethyl)-pyridine-4-boronic acid structure
|
Common Name | 3-(Boc-aminomethyl)-pyridine-4-boronic acid | ||
|---|---|---|---|---|
| CAS Number | 433969-29-0 | Molecular Weight | 252.075 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H17BN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pyridin-4-yl]boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C11H17BN2O4 |
| Molecular Weight | 252.075 |
| Exact Mass | 252.128143 |
| PSA | 91.68000 |
| LogP | 0.77 |
| Index of Refraction | 1.527 |
| InChIKey | HKBZYJMXFLKZIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCc1cnccc1B(O)O |
| HS Code | 2933399090 |
|---|
|
~63%
3-(Boc-aminomet... CAS#:433969-29-0 |
| Literature: Peukert, Stefan; Brendel, Joachim; Pirard, Bernard; Brueggemann, Andrea; Below, Peter; Kleemann, Heinz-Werner; Hemmerle, Horst; Schmidt, Wolfgang Journal of Medicinal Chemistry, 2003 , vol. 46, # 4 p. 486 - 498 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(tert-butoxycarbonylaminomethyl)pyridyl-4-boronic acid |
| Carbamic acid, N-[(4-borono-3-pyridinyl)methyl]-, 1,1-dimethylethyl ester |
| (3-(((tert-Butoxycarbonyl)amino)methyl)pyridin-4-yl)boronic acid |
| 3-(Boc-aminomethyl)-pyridine-4-boronic acid |
| {3-[({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)methyl]-4-pyridinyl}boronic acid |
| 3-(boc-aminomethyl)pyridine-4-boronic acid |