(E/Z)-Glycidyl Linoleate-d5
Modify Date: 2025-08-25 18:17:51
(E/Z)-Glycidyl Linoleate-d5 structure
|
Common Name | (E/Z)-Glycidyl Linoleate-d5 | ||
|---|---|---|---|---|
| CAS Number | 1246834-15-0 | Molecular Weight | 341.54 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 431.6±33.0 °C at 760 mmHg | |
| Molecular Formula | C21H31D5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.1±10.3 °C | |
Use of (E/Z)-Glycidyl Linoleate-d5(E/Z)-Glycidyl Linoleate-d5 is the deuterium labled (E/Z)-Glycidyl Linoleate. |
| Name | Glycidyl linoleate-d5 |
|---|---|
| Synonym | More Synonyms |
| Description | (E/Z)-Glycidyl Linoleate-d5 is the deuterium labled (E/Z)-Glycidyl Linoleate. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 431.6±33.0 °C at 760 mmHg |
| Molecular Formula | C21H31D5O3 |
| Molecular Weight | 341.54 |
| Flash Point | 164.1±10.3 °C |
| Exact Mass | 341.297821 |
| LogP | 7.69 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.483 |
| InChIKey | LOGTZDQTPQYKEN-SOGOZOQUSA-N |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCC1CO1 |
| 9,12-Octadecadienoic acid, oxiranyl-d3-methyl-d2 ester, (9Z,12Z)- |
| 2,3-Epoxypropyl Linoleate-d5 |
| Linoleic Acid 2,3-Epoxypropyl Ester-d5 |
| (2H3)-2-Oxiranyl(2H2)methyl (9Z,12Z)-9,12-octadecadienoate |
| (9Z,12Z)-9,12-Octadecadienoic Acid 2-Oxiranylmethyl Ester-d5 |