Febuxostat D9
Modify Date: 2025-09-20 18:26:41
Febuxostat D9 structure
|
Common Name | Febuxostat D9 | ||
|---|---|---|---|---|
| CAS Number | 1246819-50-0 | Molecular Weight | 325.43000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H7D9N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Febuxostat D9Febuxostat D9 is deuterium labeled Febuxostat, which is a selective xanthine oxidase inhibitor with Ki of 0.6 nM. |
| Name | 2-[3-cyano-4-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propoxy]phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Febuxostat D9 is deuterium labeled Febuxostat, which is a selective xanthine oxidase inhibitor with Ki of 0.6 nM. |
|---|---|
| Related Catalog |
| Molecular Formula | C16H7D9N2O3S |
|---|---|
| Molecular Weight | 325.43000 |
| Exact Mass | 325.14500 |
| PSA | 111.45000 |
| LogP | 3.72318 |
| InChIKey | BQSJTQLCZDPROO-KIROAFHOSA-N |
| SMILES | Cc1nc(-c2ccc(OCC(C)C)c(C#N)c2)sc1C(=O)O |
| Storage condition | 2-8℃ |
| Febuxostat-d9 |
| TEI 6720-d9 |
| 2-[3-Cyano-4-(2-methylpropoxy-d9)phenyl]-4-methyl-5-thiazolecarboxylic Acid |
| [2H9]-Febuxostat |
| 2-(3-Cyano-4-isobutyloxyphenyl-d9)-4-methyl-5-thiazolecarboxylic Acid |
| TMX 67-d9 |
| Febuxostat D9 |