Nepafenac D5 structure
|
Common Name | Nepafenac D5 | ||
|---|---|---|---|---|
| CAS Number | 1246814-53-8 | Molecular Weight | 259.31500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H9D5N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Nepafenac D5Nepafenac D5 is the deuterium labeled Nepafenac, which is a selective COX-2 inhibitor. |
| Name | Nepafenac D5 |
|---|---|
| Synonym | More Synonyms |
| Description | Nepafenac D5 is the deuterium labeled Nepafenac, which is a selective COX-2 inhibitor. |
|---|---|
| Related Catalog |
| Molecular Formula | C15H9D5N2O2 |
|---|---|
| Molecular Weight | 259.31500 |
| Exact Mass | 259.13700 |
| PSA | 86.18000 |
| LogP | 2.80910 |
| InChIKey | QEFAQIPZVLVERP-XFEWCBMOSA-N |
| SMILES | NC(=O)Cc1cccc(C(=O)c2ccccc2)c1N |
| Storage condition | 2-8℃ |
| 2-(2-amino-3-(perdeuterobenzoyl)phenyl)acetamide |
| Nepafenac-D5 |
| 2-(2-amino-3-(pentadeuterobenzoyl)phenyl)acetamide |