DSPE-PEG(2000)Cyanur structure
|
Common Name | DSPE-PEG(2000)Cyanur | ||
|---|---|---|---|---|
| CAS Number | 1246304-74-4 | Molecular Weight | 2982.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C48H91Cl2N6O8P+(OCH2CH2)N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DSPE-PEG(2000)CyanurDSPE-PEG-Cyanur is a PEG derivative containing cyanur functional group. DSPE-PEG-Cyanur can be used for PEGylation of protein under mild basic conditions. DSPE-PEG-Cyanur can be used for nanostructured lipid carrier[1][2]. |
| Name | 1,2-distearoyl-sn-glycero-3-phosphoethanolaMine-N-[cyanur(polyethylene glycol)-2000] (aMMoniuM salt) |
|---|
| Description | DSPE-PEG-Cyanur is a PEG derivative containing cyanur functional group. DSPE-PEG-Cyanur can be used for PEGylation of protein under mild basic conditions. DSPE-PEG-Cyanur can be used for nanostructured lipid carrier[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C48H91Cl2N6O8P+(OCH2CH2)N |
|---|---|
| Molecular Weight | 2982.15 |