Ethyl 5-bromo-2-methyl-1H-indole-3-carboxylate
Modify Date: 2025-09-04 11:09:56
Ethyl 5-bromo-2-methyl-1H-indole-3-carboxylate structure
|
Common Name | Ethyl 5-bromo-2-methyl-1H-indole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1245933-87-2 | Molecular Weight | 282.133 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 394.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H12BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.5±26.5 °C | |
| Name | Ethyl 5-bromo-2-methyl-1H-indole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 394.7±37.0 °C at 760 mmHg |
| Molecular Formula | C12H12BrNO2 |
| Molecular Weight | 282.133 |
| Flash Point | 192.5±26.5 °C |
| Exact Mass | 281.005127 |
| PSA | 42.09000 |
| LogP | 4.39 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | SYFCLQGHXLTDOC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)[nH]c2ccc(Br)cc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 5-bromo-2-methyl-1H-indole-3-carboxylate |
| 1H-Indole-3-carboxylic acid, 5-bromo-2-methyl-, ethyl ester |