N-Acetyl-S-(3,4-dihydroxybutyl)-L-cysteine-d7 structure
|
Common Name | N-Acetyl-S-(3,4-dihydroxybutyl)-L-cysteine-d7 | ||
|---|---|---|---|---|
| CAS Number | 1240398-27-9 | Molecular Weight | 258.34 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 573.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C9H10D7NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.4±30.1 °C | |
Use of N-Acetyl-S-(3,4-dihydroxybutyl)-L-cysteine-d7N-Acetyl-S-(3,4-dihydroxybutyl)-L-cysteine-d7 is a deuterium labeled compound. |
| Name | N-Acetyl-S-[3,4-dihydroxy(2H7)butyl]-L-cysteine |
|---|---|
| Synonym | More Synonyms |
| Description | N-Acetyl-S-(3,4-dihydroxybutyl)-L-cysteine-d7 is a deuterium labeled compound. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 573.2±50.0 °C at 760 mmHg |
| Molecular Formula | C9H10D7NO5S |
| Molecular Weight | 258.34 |
| Flash Point | 300.4±30.1 °C |
| Exact Mass | 258.126678 |
| LogP | -1.59 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | VGJNEDFZFZCLSX-NCUHYACUSA-N |
| SMILES | CC(=O)NC(CSCCC(O)CO)C(=O)O |
| N-Acetyl-S-[3,4-dihydroxy(2H7)butyl]-L-cysteine |
| L-Cysteine, N-acetyl-S-(3,4-dihydroxybutyl-1,1,2,2,3,4,4-d7)- |