Stannane,chlorotris(4-chlorophenyl)-
Stannane,chlorotris(4-chlorophenyl)- structure
|
Common Name | Stannane,chlorotris(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1235-30-9 | Molecular Weight | 488.80100 | |
| Density | N/A | Boiling Point | 469.9ºC at 760mmHg | |
| Molecular Formula | C18H12Cl4Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238ºC | |
| Name | chloro-tris(4-chlorophenyl)stannane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 469.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C18H12Cl4Sn |
| Molecular Weight | 488.80100 |
| Flash Point | 238ºC |
| Exact Mass | 487.87200 |
| LogP | 4.85250 |
| Vapour Pressure | 1.5E-08mmHg at 25°C |
| HS Code | 2931900090 |
|---|
|
~74%
Stannane,chloro... CAS#:1235-30-9 |
| Literature: Gmelin Handbook: Sn: Org.Verb.1, 1.1.1.16.6, page 169 - 176 |
|
~%
Stannane,chloro... CAS#:1235-30-9 |
| Literature: Gmelin Handbook: Sn: Org.Verb.1, 1.1.1.16.6, page 169 - 176 |
|
~%
Stannane,chloro... CAS#:1235-30-9 |
| Literature: Gmelin Handbook: Sn: Org.Verb.1, 1.1.1.16.6, page 169 - 176 |
|
~%
Stannane,chloro... CAS#:1235-30-9 |
| Literature: Gmelin Handbook: Sn: Org.Verb.1, 1.1.1.16.6, page 169 - 176 |
|
~%
Stannane,chloro... CAS#:1235-30-9 |
| Literature: Gmelin Handbook: Sn: Org.Verb.1, 1.1.1.16.6, page 169 - 176 |
CAS#:112931-14-3| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| chloro[tris(4-chlorophenyl)]stannane |
| tris(p-chlorophenyl)tin chloride |
| tri(p-chlorophenyl)tin chloride |
| Tris-(p-chlorphenyl)-zinnchlorid |
| tris(para-chlorophenyl)tin chloride |
| Stannane,chlorotris(4-chlorophenyl) |
| tri(4-chlorophenyl)-tin chloride |