5,6-dibutyl-7-methoxy-1-benzofuran-4-ol structure
|
Common Name | 5,6-dibutyl-7-methoxy-1-benzofuran-4-ol | ||
|---|---|---|---|---|
| CAS Number | 123332-43-4 | Molecular Weight | 276.37100 | |
| Density | 1.061g/cm3 | Boiling Point | 292.6ºC at 760mmHg | |
| Molecular Formula | C17H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.8ºC | |
| Name | 5,6-dibutyl-7-methoxy-1-benzofuran-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.061g/cm3 |
|---|---|
| Boiling Point | 292.6ºC at 760mmHg |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.37100 |
| Flash Point | 130.8ºC |
| Exact Mass | 276.17300 |
| PSA | 42.60000 |
| LogP | 4.83220 |
| Vapour Pressure | 0.00104mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | XIXZNMIOSSSXPJ-UHFFFAOYSA-N |
| SMILES | CCCCc1c(CCCC)c(OC)c2occc2c1O |
|
~%
5,6-dibutyl-7-m... CAS#:123332-43-4 |
| Literature: Yamashita; Schaub; Back; White; Toy; Ghazal; Burdick; Brashler; Holm Journal of Medicinal Chemistry, 1990 , vol. 33, # 2 p. 775 - 781 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-Benzofuran-4-ol,5,6-dibutyl-7-methoxy |