7-methoxy-5,6-diphenyl-1-benzofuran-4-ol
Modify Date: 2025-08-25 17:54:03
7-methoxy-5,6-diphenyl-1-benzofuran-4-ol structure
|
Common Name | 7-methoxy-5,6-diphenyl-1-benzofuran-4-ol | ||
|---|---|---|---|---|
| CAS Number | 120255-00-7 | Molecular Weight | 316.35000 | |
| Density | 1.219g/cm3 | Boiling Point | 328.9ºC at 760mmHg | |
| Molecular Formula | C21H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.7ºC | |
| Name | 7-methoxy-5,6-diphenyl-1-benzofuran-4-ol |
|---|
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 328.9ºC at 760mmHg |
| Molecular Formula | C21H16O3 |
| Molecular Weight | 316.35000 |
| Flash Point | 152.7ºC |
| Exact Mass | 316.11000 |
| PSA | 42.60000 |
| LogP | 5.48100 |
| Vapour Pressure | 9.59E-05mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | OIMNNTAJKKFDMC-UHFFFAOYSA-N |
| SMILES | COc1c(-c2ccccc2)c(-c2ccccc2)c(O)c2ccoc12 |
|
~%
7-methoxy-5,6-d... CAS#:120255-00-7 |
| Literature: Yamashita; Schaub; Back; White; Toy; Ghazal; Burdick; Brashler; Holm Journal of Medicinal Chemistry, 1990 , vol. 33, # 2 p. 775 - 781 |
|
~8%
7-methoxy-5,6-d... CAS#:120255-00-7 |
| Literature: Yamashita, A.; Toy, A.; Watt, W.; Muchmore, C. R. Tetrahedron Letters, 1988 , vol. 29, # 28 p. 3403 - 3406 |
![(4R,5S)-4,5-diphenyl-4H-cyclopenta[b]furan-6(5H)-one structure](https://image.chemsrc.com/caspic/177/120254-98-0.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |