N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-4-methylbenzamide structure
|
Common Name | N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-4-methylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 122892-77-7 | Molecular Weight | 312.40600 | |
| Density | 1.086g/cm3 | Boiling Point | 499.5ºC at 760 mmHg | |
| Molecular Formula | C19H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.9ºC | |
| Name | N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-4-methylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.086g/cm3 |
|---|---|
| Boiling Point | 499.5ºC at 760 mmHg |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.40600 |
| Flash Point | 255.9ºC |
| Exact Mass | 312.18400 |
| PSA | 41.57000 |
| LogP | 3.25630 |
| Vapour Pressure | 4.13E-10mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | FUXHLLROSCHCMP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)NCc2ccc(OCCN(C)C)cc2)cc1 |
|
~%
N-[[4-[2-(dimet... CAS#:122892-77-7 |
| Literature: Sakaguchi; Nishino; Ogawa; Iwanaga; Yasuda; Kato; Ito Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 1 p. 202 - 211 |
|
~%
N-[[4-[2-(dimet... CAS#:122892-77-7 |
| Literature: Sakaguchi; Nishino; Ogawa; Iwanaga; Yasuda; Kato; Ito Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 1 p. 202 - 211 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzamide,N-((4-(2-(dimethylamino)ethoxy)phenyl)methyl)-4-methyl |
| N-((4-(2-(Dimethylamino)ethoxy)phenyl)methyl)-4-methylbenzamide |
| N-[[4-(2-dimethylaminoethyloxy)phenyl]methyl]-4-methylbenzamide |