(4s)-4-[(1r)-2-azido-1-(benzyloxy)ethyl]-2,2-dimethyl-1,3-dioxolane structure
|
Common Name | (4s)-4-[(1r)-2-azido-1-(benzyloxy)ethyl]-2,2-dimethyl-1,3-dioxolane | ||
|---|---|---|---|---|
| CAS Number | 1228077-93-7 | Molecular Weight | 277.31900 | |
| Density | 1.116 g/mL at 25 °C(lit.) | Boiling Point | N/A | |
| Molecular Formula | C14H19N3O3 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 218 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (4S)-4-[(1R)-2-azido-1-phenylmethoxyethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.116 g/mL at 25 °C(lit.) |
|---|---|
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.31900 |
| Flash Point | 218 °F |
| Exact Mass | 277.14300 |
| PSA | 77.44000 |
| LogP | 2.48636 |
| Index of Refraction | n20/D 1.5090(lit.) |
| InChIKey | YWANFIYHLHBBCF-OLZOCXBDSA-N |
| SMILES | CC1(C)OCC(C(CN=[N+]=[N-])OCc2ccccc2)O1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Phrases | 22 |
| Safety Phrases | 36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (4S)-4-[(1R)-2-Azido-1-(benzyloxy)ethyl]-2,2-dimethyl-1,3-dioxolane |