5,5-dimethyl-2-propan-2-ylidenecyclohexane-1,3-dione structure
|
Common Name | 5,5-dimethyl-2-propan-2-ylidenecyclohexane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 122772-35-4 | Molecular Weight | 180.24400 | |
| Density | 1.133g/cm3 | Boiling Point | 290ºC at 760mmHg | |
| Molecular Formula | C11H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.4ºC | |
| Name | 5,5-dimethyl-2-propan-2-ylidenecyclohexane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 290ºC at 760mmHg |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.24400 |
| Flash Point | 143.4ºC |
| Exact Mass | 180.11500 |
| PSA | 34.14000 |
| LogP | 2.28100 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | ZDFKYRBMJLTZCZ-UHFFFAOYSA-N |
| SMILES | CC(C)=C1C(=O)CC(C)(C)CC1=O |
| HS Code | 2914299000 |
|---|
|
~1%
5,5-dimethyl-2-... CAS#:122772-35-4 |
| Literature: Ahluwalia, V. K.; Rao, J. Shailaja Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1989 , vol. 28, # 1-11 p. 81 - 82 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914299000 |
|---|---|
| Summary | 2914299000. other cyclanic, cyclenic or cyclotherpenic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 5,5-Dimethyl-2-(propan-2-ylidene)cyclohexane-1,3-dione |
| 1,3-Cyclohexanedione,5,5-dimethyl-2-(1-methylethylidene) |
| 2-Isopropylidene-5,5-dimethylcyclohexane-1,3-dione |