5-Trifluoromethyl-2-pyridylboronic acid MIDA ester
Modify Date: 2025-08-26 05:31:54
5-Trifluoromethyl-2-pyridylboronic acid MIDA ester structure
|
Common Name | 5-Trifluoromethyl-2-pyridylboronic acid MIDA ester | ||
|---|---|---|---|---|
| CAS Number | 1227700-47-1 | Molecular Weight | 302.014 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 335.8±52.0 °C at 760 mmHg | |
| Molecular Formula | C11H10BF3N2O4 | Melting Point | 207-212°C | |
| MSDS | N/A | Flash Point | 156.9±30.7 °C | |
| Name | 5-Trifluoromethyl-2-pyridylboronic acid MIDA ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 335.8±52.0 °C at 760 mmHg |
| Melting Point | 207-212°C |
| Molecular Formula | C11H10BF3N2O4 |
| Molecular Weight | 302.014 |
| Flash Point | 156.9±30.7 °C |
| Exact Mass | 302.068573 |
| Appearance of Characters | solid |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | JDIFOGCCTHAORY-UHFFFAOYSA-N |
| SMILES | C[N+]12CC(=O)O[B-]1(c1ccc(C(F)(F)F)cn1)OC(=O)C2 |
| Hazard Codes | Xi |
|---|---|
| WGK Germany | 3 |
| MFCD18909190 |
| 6-Methyl-2-[5-(trifluoromethyl)-2-pyridinyl]-1,3,6,2-dioxazaborocane-4,8-dione |
| 4H-1,3,6,2-Dioxazaborocine-4,8(5H)-dione, dihydro-6-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]- |