Ethyl 3-methoxy-5-nitrobenzoate
Modify Date: 2025-08-24 18:15:21
Ethyl 3-methoxy-5-nitrobenzoate structure
|
Common Name | Ethyl 3-methoxy-5-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 1227157-65-4 | Molecular Weight | 225.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 3-methoxy-5-nitrobenzoate |
|---|
| Molecular Formula | C10H11NO5 |
|---|---|
| Molecular Weight | 225.19800 |
| Exact Mass | 225.06400 |
| PSA | 81.35000 |
| LogP | 2.30330 |
| InChIKey | CBICIWBUDRQIBK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(OC)cc([N+](=O)[O-])c1 |
| HS Code | 2918990090 |
|---|
|
~87%
Ethyl 3-methoxy... CAS#:1227157-65-4 |
| Literature: JE IL PHARMACEUTICAL CO., LTD. Patent: US2011/218193 A1, 2011 ; Location in patent: Page/Page column 55 ; US 20110218193 A1 |
|
~%
Ethyl 3-methoxy... CAS#:1227157-65-4 |
| Literature: JE IL PHARMACEUTICAL CO., LTD. Patent: US2011/218193 A1, 2011 ; US 20110218193 A1 |
CAS#:915403-19-9| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |