6,7-DICHLORO-1,4-DIHYDROXYANTHRAQUINONE
Modify Date: 2025-08-25 17:38:41
6,7-DICHLORO-1,4-DIHYDROXYANTHRAQUINONE structure
|
Common Name | 6,7-DICHLORO-1,4-DIHYDROXYANTHRAQUINONE | ||
|---|---|---|---|---|
| CAS Number | 1225-15-6 | Molecular Weight | 309.10100 | |
| Density | 1.718g/cm3 | Boiling Point | 570.7ºC at 760mmHg | |
| Molecular Formula | C14H6Cl2O4 | Melting Point | 290ºC (dec.)(lit.) | |
| MSDS | N/A | Flash Point | 298.9ºC | |
| Name | 6,7-dichloro-1,4-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.718g/cm3 |
|---|---|
| Boiling Point | 570.7ºC at 760mmHg |
| Melting Point | 290ºC (dec.)(lit.) |
| Molecular Formula | C14H6Cl2O4 |
| Molecular Weight | 309.10100 |
| Flash Point | 298.9ºC |
| Exact Mass | 307.96400 |
| PSA | 74.60000 |
| LogP | 3.18000 |
| Vapour Pressure | 1.26E-13mmHg at 25°C |
| Index of Refraction | 1.735 |
| InChIKey | GWFVWUQOSJGENT-UHFFFAOYSA-N |
| SMILES | O=C1c2cc(Cl)c(Cl)cc2C(=O)c2c(O)ccc(O)c21 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
|
~89%
6,7-DICHLORO-1,... CAS#:1225-15-6 |
| Literature: Hua, Duy H.; Lou, Kaiyan; Havens, Josh; Perchellet, Elisabeth M.; Wang, Yang; Perchellet, Jean-Pierre; Iwamoto, Takeo Tetrahedron, 2004 , vol. 60, # 45 p. 10155 - 10163 |
|
~%
6,7-DICHLORO-1,... CAS#:1225-15-6 |
| Literature: Hoechster Farbw. Patent: DE172105 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 8, p. 276 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 6,7-Dichloroquinizarin |
| 6,7-Dichlor-chinizarin |
| 6,7-Dichloro-1,4-dihydroxyanthraquinone |
| 6,7-dichloro-1,4-dihydroxy-9,10-anthraquinone |
| 6,7-Dichlor-1,4-dihydroxy-anthrachinon |
| EINECS 214-954-2 |