Lys(MMT)-PAB-oxydiacetamide-PEG8-N3 structure
|
Common Name | Lys(MMT)-PAB-oxydiacetamide-PEG8-N3 | ||
|---|---|---|---|---|
| CAS Number | 1224601-12-0 | Molecular Weight | 1060.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C55H77N7O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lys(MMT)-PAB-oxydiacetamide-PEG8-N3Lys(MMT)-PAB-oxydiacetamide-PEG8-N3 is a cleavable antibody drug conjugate linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Lys(MMT)-PAB-oxydiacetamide-PEG8-N3 |
|---|
| Description | Lys(MMT)-PAB-oxydiacetamide-PEG8-N3 is a cleavable antibody drug conjugate linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C55H77N7O14 |
|---|---|
| Molecular Weight | 1060.24 |
| InChIKey | PKUIBTBLKQVEJS-XHIZWQFQSA-N |
| SMILES | COc1ccc(C(NCCCCC(NC(=O)COCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])C(=O)Nc2ccc(CO)cc2)(c2ccccc2)c2ccccc2)cc1 |