1,1-bis(4-chlorophenyl)propane-1,2-diol structure
|
Common Name | 1,1-bis(4-chlorophenyl)propane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 122135-77-7 | Molecular Weight | 297.17600 | |
| Density | 1.338g/cm3 | Boiling Point | 460.2ºC at 760mmHg | |
| Molecular Formula | C15H14Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.1ºC | |
| Name | 1,1-bis(4-chlorophenyl)propane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 460.2ºC at 760mmHg |
| Molecular Formula | C15H14Cl2O2 |
| Molecular Weight | 297.17600 |
| Flash Point | 232.1ºC |
| Exact Mass | 296.03700 |
| PSA | 40.46000 |
| LogP | 3.61010 |
| Vapour Pressure | 2.9E-09mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | QMKPIWKXLXVQEI-UHFFFAOYSA-N |
| SMILES | CC(O)C(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
|
~%
1,1-bis(4-chlor... CAS#:122135-77-7 |
| Literature: Skerrett; Woodcock Journal of the Chemical Society, 1952 , p. 3308,3312 Full Text Show Details Hatch; Cram Journal of the American Chemical Society, 1953 , vol. 75, p. 38,43 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1-Bis-(4-chlor-phenyl)-propan-1,2-diol |
| 1,1-bis-(4-chloro-phenyl)-propane-1,2-diol |
| 1,1-Bis(4-chlorophenyl)-1,2-propanediol |
| 1,2-Propanediol,1,1-bis(4-chlorophenyl) |