Charantadiol A structure
|
Common Name | Charantadiol A | ||
|---|---|---|---|---|
| CAS Number | 1220890-23-2 | Molecular Weight | 454.684 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 564.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H46O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.3±30.1 °C | |
Use of Charantadiol ACharantadiol A is a natural compound found in Momordica charantia L[1]. |
| Name | (1R,4S,5S,8R,9R,12S,13S,16S,19R)-5,9,17,17-Tetramethyl-8-[(2R,4E)-6-methyl-4,6-heptadien-2-yl]-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-ene-16,19-diol |
|---|---|
| Synonym | More Synonyms |
| Description | Charantadiol A is a natural compound found in Momordica charantia L[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 564.7±50.0 °C at 760 mmHg |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.684 |
| Flash Point | 295.3±30.1 °C |
| Exact Mass | 454.344696 |
| LogP | 7.22 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | SOYAGUJRHLJJFJ-UHFFFAOYSA-N |
| SMILES | C=C(C)C=CCC(C)C1CCC2(C)C3C=CC45OC(O)C3(CCC12C)C4CCC(O)C5(C)C |
| (1R,4S,5S,8R,9R,12S,13S,16S,19R)-5,9,17,17-Tetramethyl-8-[(2R,4E)-6-methyl-4,6-heptadien-2-yl]-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-ene-16,19-diol |
| 5,9-(Epoxymethano)-2H-cyclopenta[a]phenanthrene-3,18-diol, 17-[(1R,3E)-1,5-dimethyl-3,5-hexadien-1-yl]-1,3,4,8,10,11,12,13,14,15,16,17-dodecahydro-4,4,13,14-tetramethyl-, (3S,5R,8S,9S,10S,13R,14S,17R,18R)- |