[6-[5-acetyloxy-6-[[(14E)-7-acetyloxy-2-(acetyloxymethyl)-3-ethyl-8,12,16-trimethyl-5,13-dioxo-10-(2-oxoethyl)-4,17-dioxabicyclo[14.1.0]heptadec-14-en-9-yl]oxy]-4-(dimethylamino)-2-methyloxan-3-yl]oxy-4-hydroxy-2,4-dimethyloxan-3-yl] 3-methylbutanoate structure
|
Common Name | [6-[5-acetyloxy-6-[[(14E)-7-acetyloxy-2-(acetyloxymethyl)-3-ethyl-8,12,16-trimethyl-5,13-dioxo-10-(2-oxoethyl)-4,17-dioxabicyclo[14.1.0]heptadec-14-en-9-yl]oxy]-4-(dimethylamino)-2-methyloxan-3-yl]oxy-4-hydroxy-2,4-dimethyloxan-3-yl] 3-methylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 122076-87-3 | Molecular Weight | 968.13200 | |
| Density | 1.22g/cm3 | Boiling Point | 925.3ºC at 760 mmHg | |
| Molecular Formula | C49H77NO18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 513.4ºC | |
| Name | [6-[5-acetyloxy-6-[[(14E)-7-acetyloxy-2-(acetyloxymethyl)-3-ethyl-8,12,16-trimethyl-5,13-dioxo-10-(2-oxoethyl)-4,17-dioxabicyclo[14.1.0]heptadec-14-en-9-yl]oxy]-4-(dimethylamino)-2-methyloxan-3-yl]oxy-4-hydroxy-2,4-dimethyloxan-3-yl] 3-methylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 925.3ºC at 760 mmHg |
| Molecular Formula | C49H77NO18 |
| Molecular Weight | 968.13200 |
| Flash Point | 513.4ºC |
| Exact Mass | 967.51400 |
| PSA | 238.56000 |
| LogP | 4.19410 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | QSPHUZGDGNBMHM-FBMGVBCBSA-N |
| SMILES | CCC1OC(=O)CC(OC(C)=O)C(C)C(OC2OC(C)C(OC3CC(C)(O)C(OC(=O)CC(C)C)C(C)O3)C(N(C)C)C2OC(C)=O)C(CC=O)CC(C)C(=O)C=CC2(C)OC2C1COC(C)=O |
|
~90%
[6-[5-acetyloxy... CAS#:122076-87-3 |
| Literature: Fishman, Andrew G.; Mallams, Alan K.; Rossman, Randall R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1989 , p. 787 - 798 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3,2',3'-Tetramethoxy-benzoin |
| o-Veratroin |
| 2',3,23-tri-O-acetyl-23-O-demycinosyl-12,13-epoxy-4''-O-isovaleryltylosin |