5-Bromo-6-hydroxypicolinic acid structure
|
Common Name | 5-Bromo-6-hydroxypicolinic acid | ||
|---|---|---|---|---|
| CAS Number | 1214385-51-9 | Molecular Weight | 218.005 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 437.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C6H4BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.5±28.7 °C | |
| Name | 5-Bromo-6-hydroxypicolinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 437.6±45.0 °C at 760 mmHg |
| Molecular Formula | C6H4BrNO3 |
| Molecular Weight | 218.005 |
| Flash Point | 218.5±28.7 °C |
| Exact Mass | 216.937454 |
| PSA | 70.42000 |
| LogP | 0.31 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | YVVISLCKIQNUDL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Br)c(=O)[nH]1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Bromo-6-hydroxy-2-pyridinecarboxylic acid |
| 5-Bromo-6-hydroxypyridine-2-carboxylic acid |
| 2-pyridinecarboxylic acid, 5-bromo-6-hydroxy- |
| 5-bromo-6-oxo-1H-pyridine-2-carboxylic acid |