(α)-Ac4ManNAz structure
|
Common Name | (α)-Ac4ManNAz | ||
|---|---|---|---|---|
| CAS Number | 1213701-11-1 | Molecular Weight | 430.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22N4O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (α)-Ac4ManNAz(α)-Ac4ManNAz can be taken up by cells and used to modify glycosylation. (α)-Ac4ManNAz can be used for glycosylation biomarker research[1]. |
| Name | (α)-Ac4ManNAz |
|---|
| Description | (α)-Ac4ManNAz can be taken up by cells and used to modify glycosylation. (α)-Ac4ManNAz can be used for glycosylation biomarker research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H22N4O10 |
|---|---|
| Molecular Weight | 430.37 |
| InChIKey | HGMISDAXLUIXKM-ZIRHEVKLSA-N |
| SMILES | CC(=O)OCC1OC(OC(C)=O)C(NC(=O)CN=[N+]=[N-])C(OC(C)=O)C1OC(C)=O |