Utreloxastat structure
|
Common Name | Utreloxastat | ||
|---|---|---|---|---|
| CAS Number | 1213269-96-5 | Molecular Weight | 276.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H28O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of UtreloxastatUtreloxastat is a compound used for the research of the disorders including α-synucleinopathies, tauopathies, Amyotrophic lateral sclerosis (ALS), traumatic brain injury, and ischemic-reperfusion related injuries (patent WO2020081879A2, example A1)[1]. |
| Name | Utreloxastat |
|---|
| Description | Utreloxastat is a compound used for the research of the disorders including α-synucleinopathies, tauopathies, Amyotrophic lateral sclerosis (ALS), traumatic brain injury, and ischemic-reperfusion related injuries (patent WO2020081879A2, example A1)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H28O2 |
|---|---|
| Molecular Weight | 276.41 |
| InChIKey | IJWAQTHZBDBIID-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC1=C(C)C(=O)C(C)=C(C)C1=O |