tert-butyl 4-amino-4-(trifluoromethyl)piperidine-1-carboxylate
Modify Date: 2025-09-05 16:52:48
tert-butyl 4-amino-4-(trifluoromethyl)piperidine-1-carboxylate structure
|
Common Name | tert-butyl 4-amino-4-(trifluoromethyl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1211582-61-4 | Molecular Weight | 268.276 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 278.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H19F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.0±27.3 °C | |
| Name | tert-butyl 4-amino-4-(trifluoromethyl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 278.1±40.0 °C at 760 mmHg |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.276 |
| Flash Point | 122.0±27.3 °C |
| Exact Mass | 268.139862 |
| PSA | 55.56000 |
| LogP | 1.91 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.446 |
| InChIKey | NYPUFDUCDMKIGM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)(C(F)(F)F)CC1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperidinecarboxylic acid, 4-amino-4-(trifluoromethyl)-, 1,1-dimethylethyl ester |
| 4-amino-4-trifluoromethyl-piperidine-1-carboxylic acid tert-butyl ester |
| 2-Methyl-2-propanyl 4-amino-4-(trifluoromethyl)-1-piperidinecarboxylate |