4-Benzyloxy-5-methoxy-2-nitrotoluene structure
|
Common Name | 4-Benzyloxy-5-methoxy-2-nitrotoluene | ||
|---|---|---|---|---|
| CAS Number | 121086-26-8 | Molecular Weight | 273.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO4 | Melting Point | 122-124ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methoxy-5-methyl-4-nitro-2-phenylmethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 122-124ºC |
|---|---|
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.28400 |
| Exact Mass | 273.10000 |
| PSA | 64.28000 |
| LogP | 4.01400 |
| InChIKey | LBLJFBODCWOVTJ-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c([N+](=O)[O-])cc1OCc1ccccc1 |
|
~90%
4-Benzyloxy-5-m... CAS#:121086-26-8 |
| Literature: Cannon, Joseph G.; Qijie, Pang Journal of Medicinal Chemistry, 1991 , vol. 34, # 3 p. 1079 - 1082 |
|
~%
4-Benzyloxy-5-m... CAS#:121086-26-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 34, # 3 p. 1079 - 1082 |
|
~%
4-Benzyloxy-5-m... CAS#:121086-26-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 34, # 3 p. 1079 - 1082 |
|
~%
4-Benzyloxy-5-m... CAS#:121086-26-8 |
| Literature: Archiv der Pharmazie (Weinheim, Germany), , p. 284 |
| 2-Nitro-5-methoxy-4-benzyloxy-toluol |
| 4-BENZYLOXY-5-METHOXY-2-NITROTOLUENE |
| 6-Nitro-kreosol-benzylaether |
| 4-Benzyloxy-5-methoxy-2-nitro-toluol |