SynB1 structure
|
Common Name | SynB1 | ||
|---|---|---|---|---|
| CAS Number | 1207092-86-1 | Molecular Weight | 2171.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C89H151N37O27 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SynB1SynB1 is a cell penetrating polypeptide, internalized by, or is associated with lipid vesicle (LV). SynB1 can be used to lipid vesicle-mediated delivery to cells[1]. |
| Name | SynB1 |
|---|
| Description | SynB1 is a cell penetrating polypeptide, internalized by, or is associated with lipid vesicle (LV). SynB1 can be used to lipid vesicle-mediated delivery to cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C89H151N37O27 |
|---|---|
| Molecular Weight | 2171.38 |
| InChIKey | GNJNMZGRIJXXHP-UATHOKIWSA-N |
| SMILES | CC(C)CC(NC(=O)C(CCCNC(=N)N)NC(=O)CNC(=O)CNC(=O)C(N)CCCNC(=N)N)C(=O)NC(CO)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CO)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)NC(Cc1ccccc1)C(=O)NC(CO)C(=O)NC(C(=O)NC(CO)C(=O)NC(C(=O)NCC(=O)NC(CCCNC(=N)N)C(=O)NC(C)C(=O)O)C(C)O)C(C)O |