3-(2-hydroxyethyl)-1H,3H-quinazoline-2,4-dione structure
|
Common Name | 3-(2-hydroxyethyl)-1H,3H-quinazoline-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 1207-75-6 | Molecular Weight | 206.19800 | |
| Density | 1.361g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-hydroxyethyl)-1H-quinazoline-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.361g/cm3 |
|---|---|
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.19800 |
| Exact Mass | 206.06900 |
| PSA | 75.09000 |
| Index of Refraction | 1.6 |
| InChIKey | DSUNWRHRAQZLNC-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2ccccc2c(=O)n1CCO |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(2-hydroxy-ethyl)-1H-quinazoline-2,4-dione |
| 2,4(1h,3h)-quinazolinedione,3-(2-hydroxyethyl) |
| 3-(2-hydroxyethyl)quinazoline-2,4(1H,3H)-dione |
| 3-(2-hydroxyethyl)-1,2,3,4-tetrahydroquinazoline-2,4-dione |
| 3-(2-hydroxyethyl)-2,4(1H,3H)-quinazolinedione |
| 3-(2-hydroxyethyl)-1H,3H-quinazoline-2,4-dione |
| 2,4-Dioxo-3-(2-hydroxyethyl)-1,2,3,4-tetrahydroquinazoline |