Murrayacarpin B structure
|
Common Name | Murrayacarpin B | ||
|---|---|---|---|---|
| CAS Number | 120693-44-9 | Molecular Weight | 236.221 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 467.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.8±22.2 °C | |
Use of Murrayacarpin BMurrayacarpin B is a phenolic compound. Murrayacarpin B can be isolated from the leaves and fruits of F. carica[1]. |
| Name | 8-(Hydroxymethyl)-5,7-dimethoxy-2H-chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Murrayacarpin B is a phenolic compound. Murrayacarpin B can be isolated from the leaves and fruits of F. carica[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 467.8±45.0 °C at 760 mmHg |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.221 |
| Flash Point | 185.8±22.2 °C |
| Exact Mass | 236.068466 |
| LogP | 0.87 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | FAMKZZUKJPKMBR-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2ccc(=O)oc2c1CO |
| 2H-1-Benzopyran-2-one, 8-(hydroxymethyl)-5,7-dimethoxy- |
| 8-(Hydroxymethyl)-5,7-dimethoxy-2H-chromen-2-one |