Z 944
Modify Date: 2025-08-25 15:48:54
Z 944 structure
|
Common Name | Z 944 | ||
|---|---|---|---|---|
| CAS Number | 1199236-64-0 | Molecular Weight | 383.88800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H27ClFN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Z 944Z944 is a T-type calcium channel antagonist that rescues impairments in crossmodal and visual recognition memory. |
| Name | N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3-chloro-5-fluorobenzamide |
|---|---|
| Synonym | More Synonyms |
| Description | Z944 is a T-type calcium channel antagonist that rescues impairments in crossmodal and visual recognition memory. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H27ClFN3O2 |
|---|---|
| Molecular Weight | 383.88800 |
| Exact Mass | 383.17800 |
| PSA | 68.42000 |
| LogP | 4.18860 |
| InChIKey | JOCLITFYIMJMNK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)CN1CCC(CNC(=O)c2cc(F)cc(Cl)c2)CC1 |
| Storage condition | -20°C |
| Z-944 |