1-Ethyl-4-(methoxycarbonyl)pyridinium iodide structure
|
Common Name | 1-Ethyl-4-(methoxycarbonyl)pyridinium iodide | ||
|---|---|---|---|---|
| CAS Number | 1199-65-1 | Molecular Weight | 293.102 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12INO2 | Melting Point | 114-116 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-ethyl-4-methoxycarbonylpyridinium iodide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 114-116 °C(lit.) |
|---|---|
| Molecular Formula | C9H12INO2 |
| Molecular Weight | 293.102 |
| Exact Mass | 292.991272 |
| PSA | 30.18000 |
| InChIKey | NGEAJXXGUZQCPN-UHFFFAOYSA-M |
| SMILES | CC[n+]1ccc(C(=O)OC)cc1.[I-] |
| Stability | Stable. Incompatible with strong oxidizing agents. Hygroscopic. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
|
~94%
1-Ethyl-4-(meth... CAS#:1199-65-1 |
| Literature: Langhals, Heinz Chemische Berichte, 1981 , vol. 114, # 8 p. 2907 - 2913 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Micropolarity of sodium bis (2-ethylhexyl) sulfosuccinate reverse micelles prepared in supercritical ethane and near-critical propane. Shervani Z and Ikushima Y.
Coll. Polymer Sci. 277(6) , 595-600, (1999)
|
|
|
Salts dissolved in salts: ionic liquid mixtures. Lui MY, et al.
Chem. Sci. 2(8) , 1491-96, (2011)
|
|
|
Synthesis, characterization, and complexation of tetraarylborates with aromatic cations and their use in chemical sensors.
Chemistry 11(7) , 2071-80, (2005) Five aromatic borate anions, namely tetrakis(4-phenoxyphenyl)borate (1), tetrakis(biphenyl)borate (2), tetrakis(2-naphthyl)borate (3), tetrakis(4-phenylphenol)borate (4), and tetrakis(4-phenoxy)borate... |
| MFCD00011996 |
| 4-Carbomethoxy-1-ethylpyridinium Iodide |
| methyl 1-ethylpyridin-1-ium-4-carboxylate,iodide |
| Pyridinium, 1-ethyl-4- (methoxycarbonyl)-, iodide |
| 1-Ethyl-4-(methoxycarbonyl)pyridinium iodide |
| Pyridinium, 1-ethyl-4-(methoxycarbonyl)-, iodide (1:1) |