2,2,3,3-tetrafluoro-5-amino-1,4-benzodioxene structure
|
Common Name | 2,2,3,3-tetrafluoro-5-amino-1,4-benzodioxene | ||
|---|---|---|---|---|
| CAS Number | 119895-70-4 | Molecular Weight | 223.124 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 221.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H5F4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.6±27.3 °C | |
| Name | 2,2,3,3-tetrafluoro-1,4-benzodioxin-5-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 221.2±40.0 °C at 760 mmHg |
| Molecular Formula | C8H5F4NO2 |
| Molecular Weight | 223.124 |
| Flash Point | 87.6±27.3 °C |
| Exact Mass | 223.025635 |
| PSA | 44.48000 |
| LogP | 2.93 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.500 |
| InChIKey | UPOWEJQQELYQIJ-UHFFFAOYSA-N |
| SMILES | Nc1cccc2c1OC(F)(F)C(F)(F)O2 |
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S36/37/39-S45 |
| HS Code | 2932999099 |
|
~%
2,2,3,3-tetrafl... CAS#:119895-70-4 |
| Literature: US5260460 A1, ; |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-amino-2,2,3,3-tetrafluoro-1,4-benzodioxane |
| 2,2,3,3-Tetrafluoro-5-Amino-1,4-Benzodioxene |
| 5-amino-2,2,3,3-tetrafluoro-benzo(1.4)dioxane |
| 2,2,3,3-tetrafluoro-5-amino-1,4-benzodioxine |
| 2,2,3,3-Tetrafluoro-2,3-dihydrobenzo[b][1,4]dioxin-5-amine |
| 2,2,3,3-Tetrafluoro-2,3-dihydro-1,4-benzodioxin-5-amine |
| 2,2,3,3-tetrafluoro-2,3-dihydro-benzo[1,4]dioxin-5-ylamine |
| 2,2,3,3-tetrafluoro-5-aminobenzodioxene |
| MFCD00792421 |
| 1,4-Benzodioxin-5-amine, 2,2,3,3-tetrafluoro-2,3-dihydro- |
| PC5423 |
| 8,8,9,9-tetrafluoro-7,10-dioxabicyclo[4.4.0]deca-1,3,5-trien-2-amine |