(R)-(+)-1-BOC-2-TERT-BUTYL-3-METHYL-4-IMIDAZOLIDINONE structure
|
Common Name | (R)-(+)-1-BOC-2-TERT-BUTYL-3-METHYL-4-IMIDAZOLIDINONE | ||
|---|---|---|---|---|
| CAS Number | 119838-44-7 | Molecular Weight | 256.34100 | |
| Density | 1.064g/cm3 | Boiling Point | 355.3ºC at 760mmHg | |
| Molecular Formula | C13H24N2O3 | Melting Point | 68-70ºC(lit.) | |
| MSDS | N/A | Flash Point | 168.7ºC | |
| Name | tert-butyl (2R)-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.064g/cm3 |
|---|---|
| Boiling Point | 355.3ºC at 760mmHg |
| Melting Point | 68-70ºC(lit.) |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.34100 |
| Flash Point | 168.7ºC |
| Exact Mass | 256.17900 |
| PSA | 49.85000 |
| LogP | 1.94350 |
| Vapour Pressure | 3.15E-05mmHg at 25°C |
| Index of Refraction | 1.4365 |
| InChIKey | HJJLVATZPPJBNG-SNVBAGLBSA-N |
| SMILES | CN1C(=O)CN(C(=O)OC(C)(C)C)C1C(C)(C)C |
| Storage condition | 2-8°C |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2933990090 |
|
~%
(R)-(+)-1-BOC-2... CAS#:119838-44-7 |
| Literature: Synthesis, , # 24 art. no. T83611SS, p. 4059 - 4067 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00075100 |
| (R)-(+)-1-(tert-Butoxycarbonyl)-2-tert-butyl-3-methyl-4-imidazolidinone |