3-(Methylsulfonyl)-L-phenylalanine phenylmethyl ester hydrochloride structure
|
Common Name | 3-(Methylsulfonyl)-L-phenylalanine phenylmethyl ester hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1194550-59-8 | Molecular Weight | 369.863 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3-(Methylsulfonyl)-L-phenylalanine phenylmethyl ester hydrochloride(S)-Benzyl 2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride is a phenylalanine derivative[1]. |
| Name | benzyl (S)-2-amino-3-(3-(methylsulfonyl)phenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-Benzyl 2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride is a phenylalanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Molecular Formula | C17H20ClNO4S |
|---|---|
| Molecular Weight | 369.863 |
| Exact Mass | 369.080170 |
| PSA | 94.84000 |
| LogP | 4.28640 |
| InChIKey | QMFDSGLDMSBMLX-NTISSMGPSA-N |
| SMILES | CS(=O)(=O)c1cccc(CC(N)C(=O)OCc2ccccc2)c1.Cl |
| Benzyl 3-(methylsulfonyl)-L-phenylalaninate hydrochloride (1:1) |
| L-Phenylalanine, 3-(methylsulfonyl)-, phenylmethyl ester, hydrochloride (1:1) |
| benzyl (S)-2-amino-3-(3-(methylsulfonyl)phenyl)propanoate |
| 3-(Methylsulfonyl)-L-phenylalanine phenylmethyl ester hydrochloride |
| Lifitegrast Intermediate 4 |