ethyl 4-cyclopropyl-2-methylsulfanylpyrimidine-5-carboxylate structure
|
Common Name | ethyl 4-cyclopropyl-2-methylsulfanylpyrimidine-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1191094-23-1 | Molecular Weight | 238.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-cyclopropyl-2-methylsulfanylpyrimidine-5-carboxylate |
|---|
| Molecular Formula | C11H14N2O2S |
|---|---|
| Molecular Weight | 238.30600 |
| Exact Mass | 238.07800 |
| PSA | 77.38000 |
| LogP | 2.25260 |
| InChIKey | JWQNZVNBLPBLTB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc(SC)nc1C1CC1 |
| HS Code | 2933599090 |
|---|
|
~94%
ethyl 4-cyclopr... CAS#:1191094-23-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 55, # 23 p. 10652 - 10661 |
|
~%
ethyl 4-cyclopr... CAS#:1191094-23-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 55, # 23 p. 10652 - 10661 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |