Malathion Diacid structure
|
Common Name | Malathion Diacid | ||
|---|---|---|---|---|
| CAS Number | 1190-28-9 | Molecular Weight | 274.25200 | |
| Density | 1.559g/cm3 | Boiling Point | 358.7ºC at 760mmHg | |
| Molecular Formula | C6H11O6PS2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 170.8ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 2-dimethoxyphosphinothioylsulfanylbutanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.559g/cm3 |
|---|---|
| Boiling Point | 358.7ºC at 760mmHg |
| Molecular Formula | C6H11O6PS2 |
| Molecular Weight | 274.25200 |
| Flash Point | 170.8ºC |
| Exact Mass | 273.97300 |
| PSA | 160.26000 |
| LogP | 1.81540 |
| Vapour Pressure | 4.06E-06mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | NIUNKPWHNGMQRE-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)SC(CC(=O)O)C(=O)O |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H410 |
| Precautionary Statements | P273-P280-P301 + P312 + P330-P333 + P313-P391-P501 |
| RIDADR | UN 2783 |
| RTECS | EJ9898500 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2931900090 |
|
~%
Malathion Diacid CAS#:1190-28-9 |
| Literature: Journal of Agricultural and Food Chemistry, , vol. 54, # 3 p. 836 - 842 |
|
~%
Malathion Diacid CAS#:1190-28-9 |
| Literature: NoevenytermelesChem.Abstr., , vol. 5, p. 343,345 NoevenytermelesChem.Abstr., , p. 3665 J.econ.Entomol., , vol. 49, p. 185 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Malathion diacid |
| dimethoxythiophosphorylsulfanyl-succinic acid |
| Dimethoxythiophosphorylmercapto-bernsteinsaeure |
| Malathiondicarboxylic Acid |