Roflumilast-d3 structure
|
Common Name | Roflumilast-d3 | ||
|---|---|---|---|---|
| CAS Number | 1189992-00-4 | Molecular Weight | 406.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H11D3Cl2F2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Roflumilast-d3Roflumilast-d3 is deuterium labeled Roflumilast. Roflumilast is a selective PDE4 inhibitor with IC50s of 0.7, 0.9, 0.7, and 0.2 nM for PDE4A1, PDEA4, PDEB1, and PDEB2, respectively, without affecting PDE1, PDE2, PDE3 or PDE5 isoenzymes from various cells. |
| Name | N-(3,5-dichloropyridin-4-yl)-3-[dideuterio-(1-deuteriocyclopropyl)methoxy]-4-(difluoromethoxy)benzamide |
|---|---|
| Synonym | More Synonyms |
| Description | Roflumilast-d3 is deuterium labeled Roflumilast. Roflumilast is a selective PDE4 inhibitor with IC50s of 0.7, 0.9, 0.7, and 0.2 nM for PDE4A1, PDEA4, PDEB1, and PDEB2, respectively, without affecting PDE1, PDE2, PDE3 or PDE5 isoenzymes from various cells. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C17H11D3Cl2F2N2O3 |
|---|---|
| Molecular Weight | 406.23 |
| Exact Mass | 405.05400 |
| PSA | 63.68000 |
| LogP | 4.45280 |
| InChIKey | MNDBXUUTURYVHR-YBGYDHGYSA-N |
| SMILES | O=C(Nc1c(Cl)cncc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1 |
| Roflumilast-d3 |