3-(4-methoxyphenoxy)-1-propanesulfonyl
Modify Date: 2025-08-26 19:21:47
3-(4-methoxyphenoxy)-1-propanesulfonyl structure
|
Common Name | 3-(4-methoxyphenoxy)-1-propanesulfonyl | ||
|---|---|---|---|---|
| CAS Number | 118943-25-2 | Molecular Weight | 264.72600 | |
| Density | 1.304g/cm3 | Boiling Point | 389.4ºC at 760 mmHg | |
| Molecular Formula | C10H13ClO4S | Melting Point | 45-46.7ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 3-(4-methoxyphenoxy)propane-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 389.4ºC at 760 mmHg |
| Melting Point | 45-46.7ºC(lit.) |
| Molecular Formula | C10H13ClO4S |
| Molecular Weight | 264.72600 |
| Flash Point | >230 °F |
| Exact Mass | 264.02200 |
| PSA | 60.98000 |
| LogP | 3.11350 |
| Vapour Pressure | 6.41E-06mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | UFZBQBXKJZWBBV-UHFFFAOYSA-N |
| SMILES | COc1ccc(OCCCS(=O)(=O)Cl)cc1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2909309090 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD04039947 |
| i01-8799 |