tert-Butyl 4-aminopiperazine-1-carboxylate structure
|
Common Name | tert-Butyl 4-aminopiperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 118753-66-5 | Molecular Weight | 201.266 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 281.0±33.0 °C at 760 mmHg | |
| Molecular Formula | C9H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.7±25.4 °C | |
| Name | tert-butyl 4-aminopiperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 281.0±33.0 °C at 760 mmHg |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.266 |
| Flash Point | 123.7±25.4 °C |
| Exact Mass | 201.147720 |
| PSA | 58.80000 |
| LogP | -0.66 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.500 |
| InChIKey | QMZFIRHRGPLKEV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(N)CC1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933599090 |
|
~99%
tert-Butyl 4-am... CAS#:118753-66-5 |
| Literature: TANABE SEIYAKU CO., LTD. Patent: WO2007/46550 A1, 2007 ; Location in patent: Page/Page column 120 ; WO 2007/046550 A1 |
|
~%
tert-Butyl 4-am... CAS#:118753-66-5 |
| Literature: MACIELAG, Mark J.; Tennakoon, Manomi Patent: US2009/275594 A1, 2009 ; Location in patent: Page/Page column 19 ; |
|
~%
tert-Butyl 4-am... CAS#:118753-66-5 |
| Literature: Nazare, Marc; Essrich, Melanie; Will, David William; Matter, Hans; Ritter, Kurt; Wehner, Volkmar Patent: US2003/199689 A1, 2003 ; Location in patent: Page/Page column 76 ; |
|
~%
tert-Butyl 4-am... CAS#:118753-66-5 |
| Literature: Roussel Uclaf Patent: US4839358 A1, 1989 ; US 4839358 A |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 4-amino-1-piperazinecarboxylate |
| tert-Butyl 4-aminopiperazine-1-carboxylate |
| tertbutyl 4-amino-1-piperazine carboxylate |
| 1,1-dimethylethyl 4-amino-1-piperazinecarboxylate |
| AmbotzBNN1033 |
| 1-Piperazinecarboxylicacid,4-amino-,1,1-dimethylethyl ester |
| 4-Amino-1-tert-butoxycarbonylpiperazine |
| 1-Piperazinecarboxylic acid, 4-amino-, 1,1-dimethylethyl ester |
| 4-Aminopiperazine-1-carboxylic acid tert-butyl ester |
| 1-tert-Butyloxycarbonyl-4-amino-piperazine |