DL-Aspartic acid hemimagnesium salt
Modify Date: 2025-08-21 19:17:54
DL-Aspartic acid hemimagnesium salt structure
|
Common Name | DL-Aspartic acid hemimagnesium salt | ||
|---|---|---|---|---|
| CAS Number | 1187-91-3 | Molecular Weight | 174.41500 | |
| Density | N/A | Boiling Point | 264.1ºC at 760 mmHg | |
| Molecular Formula | C4H8MgNO5+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.5ºC | |
Use of DL-Aspartic acid hemimagnesium saltDL-Aspartic acid hemimagnesium salt is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | magnesium,2-amino-4-hydroxy-4-oxobutanoate,hydrate |
|---|---|
| Synonym | More Synonyms |
| Description | DL-Aspartic acid hemimagnesium salt is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Boiling Point | 264.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C4H8MgNO5+ |
| Molecular Weight | 174.41500 |
| Flash Point | 113.5ºC |
| Exact Mass | 174.02500 |
| PSA | 112.68000 |
| Vapour Pressure | 0.00289mmHg at 25°C |
| InChIKey | RXMQCXCANMAVIO-UHFFFAOYSA-L |
| SMILES | NC(CC(=O)O)C(=O)[O-].NC(CC(=O)O)C(=O)[O-].[Mg+2] |
| WGK Germany | 3 |
|---|
|
~49%
DL-Aspartic aci... CAS#:1187-91-3 |
| Literature: Schmidbaur, Hubert; Mueller, Gerhard; Riede, Juergen; Manninger, Gebhard; Helbig, Joachim Angewandte Chemie, 1986 , vol. 98, # 11 p. 1014 - 1016 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| magnesium 2-amino-4-hydroxy-4-oxobutanoate hydrate |
| magnesium DL-aspartate |
| DL-Asparticacidhemimagnesiumsalt |
| magnesium aspartate complex |
| MFCD00063084 |
| Magnesium dihydrogen di-DL-aspartate |
| magnesium 2-azanyl-4-oxidanyl-4-oxidanylidene-butanoate hydrate |
| EINECS 214-702-1 |