fentanyl-d5
Modify Date: 2025-08-20 18:20:50
fentanyl-d5 structure
|
Common Name | fentanyl-d5 | ||
|---|---|---|---|---|
| CAS Number | 118357-29-2 | Molecular Weight | 341.50100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23D5N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 9℃ | |
| Symbol |
GHS02, GHS06, GHS08 |
Signal Word | Danger | |
| Name | fentanyl-d5 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H23D5N2O |
|---|---|
| Molecular Weight | 341.50100 |
| Flash Point | 9℃ |
| Exact Mass | 341.25200 |
| PSA | 23.55000 |
| LogP | 4.07460 |
| InChIKey | PJMPHNIQZUBGLI-SCUSKTIWSA-N |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1 |
| Storage condition | 2-8°C |
| Symbol |
GHS02, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370 |
| Precautionary Statements | P210-P260-P280-P301 + P310-P311 |
| Hazard Codes | F,T |
| Risk Phrases | 11-23/24/25-39/23/24/25 |
| Safety Phrases | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
|
L-F001, a multifunctional ROCK inhibitor prevents paraquat-induced cell death through attenuating ER stress and mitochondrial dysfunction in PC12 cells.
Biochem. Biophys. Res. Commun. 464 , 794-9, (2015) Paraquat (PQ) was demonstrated to induce dopaminergic neuron death and is used as a Parkinson's disease (PD) mimetic. Amounting evidences demonstrated that Rho/ROCK may a novel target for the therapy ... |
| PROPANAMIDE,N-(PHENYL-D5)-N-[1-(2-PHENYLETHYL)-4-PIPERIDINYL]- |
| Fentanyl-d5 (N-phenyl-d5) |