PHM-27 (human) structure
|
Common Name | PHM-27 (human) | ||
|---|---|---|---|---|
| CAS Number | 118025-43-7 | Molecular Weight | 2985.41000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C135H214N34O40S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PHM-27 (human)PHM-27 (human) is a human prepro-vasoactive intestinal polypeptide (27 amino acid). PHM-27 (human) is a potent the human calcitonin receptor agonist with an EC50 of 11 nM. PHM-27 (human) efficiently enhances glucose-induced insulin secretion from beta cells by an autocrine mechanism[1][2][3]. |
| Name | PHM 27 (human) |
|---|---|
| Synonym | More Synonyms |
| Description | PHM-27 (human) is a human prepro-vasoactive intestinal polypeptide (27 amino acid). PHM-27 (human) is a potent the human calcitonin receptor agonist with an EC50 of 11 nM. PHM-27 (human) efficiently enhances glucose-induced insulin secretion from beta cells by an autocrine mechanism[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
EC50: 11 nM (human calcitonin receptor)[2] |
| References |
| Molecular Formula | C135H214N34O40S |
|---|---|
| Molecular Weight | 2985.41000 |
| Exact Mass | 2983.55000 |
| PSA | 1234.12000 |
| LogP | 2.92740 |
| InChIKey | YLBIOQUUAYXLJJ-UHFFFAOYSA-N |
| SMILES | CSCCC(NC(=O)C(CC(C)C)NC(=O)C(CO)NC(=O)C(CCC(=O)O)NC(=O)C(CC(C)C)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(C)NC(=O)C(CO)NC(=O)C(CC(C)C)NC(=O)C(CCC(N)=O)NC(=O)CNC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(CCCCN)NC(=O)C(CO)NC(=O)C(Cc1ccccc1)NC(=O)C(CC(=O)O)NC(=O)C(CO)NC(=O)C(NC(=O)C(Cc1ccccc1)NC(=O)C(NC(=O)CNC(=O)C(CC(=O)O)NC(=O)C(C)NC(=O)C(N)Cc1c[nH]cn1)C(C)C)C(C)O)C(N)=O |
| phm,human |
| h-his-ala-asp-gly-val-phe-thr-ser-asp-phe-ser-lys-leu-leu-gly-gln-leu-ser-ala-lys-lys-tyr-leu-glu-ser-leu-met-nh2 |
| peptide histidine methionine,human |
| his-ala-asp-gly-val-phe-thr-ser-asp-phe-ser-lys-leu-leu-gly-gln-leu-ser-ala-lys-lys-tyr-leu-glu-ser-leu-met-nh2 |
| m.w. 2985.41 c135h214n34o40s |