2-(4-bromophenyl)-6-iodoimidazo(1 2-a)p& structure
|
Common Name | 2-(4-bromophenyl)-6-iodoimidazo(1 2-a)p& | ||
|---|---|---|---|---|
| CAS Number | 118000-66-1 | Molecular Weight | 399.02400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8BrIN2 | Melting Point | 212-216ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-(4-bromophenyl)-6-iodoimidazo[1,2-a]pyridine |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 212-216ºC |
|---|---|
| Molecular Formula | C13H8BrIN2 |
| Molecular Weight | 399.02400 |
| Exact Mass | 397.89200 |
| PSA | 17.30000 |
| LogP | 4.36840 |
| InChIKey | DOUYIPIXURZQRX-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2cn3cc(I)ccc3n2)cc1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~%
2-(4-bromopheny... CAS#:118000-66-1 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 25, # 1 p. 129 - 137 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00444892 |