Acetylepipodophyllotoxin
Modify Date: 2025-08-26 12:49:11
Acetylepipodophyllotoxin structure
|
Common Name | Acetylepipodophyllotoxin | ||
|---|---|---|---|---|
| CAS Number | 1180-35-4 | Molecular Weight | 456.44 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 595.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H24O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.3±30.2 °C | |
Use of AcetylepipodophyllotoxinEpipodophyllotoxin acetate (4-O-Epipodophyllotoxinyl acetate; compound 4) is a cyclolignan that exhibits antineoplastic and antiviral activities. Epipodophyllotoxin acetate inhibits HSV and VSV, with IC50s of 0.2 and 0.1 μg/mL, respectively[1]. |
| Name | (5S,5aR,8aR,9R)-8-Oxo-9-(3,4,5-trimethoxyphenyl)-5,5a,6,8,8a,9-he xahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-5-yl acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Epipodophyllotoxin acetate (4-O-Epipodophyllotoxinyl acetate; compound 4) is a cyclolignan that exhibits antineoplastic and antiviral activities. Epipodophyllotoxin acetate inhibits HSV and VSV, with IC50s of 0.2 and 0.1 μg/mL, respectively[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 595.3±50.0 °C at 760 mmHg |
| Molecular Formula | C24H24O9 |
| Molecular Weight | 456.44 |
| Flash Point | 257.3±30.2 °C |
| Exact Mass | 456.142029 |
| PSA | 98.75000 |
| LogP | 2.03 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | SASVNKPCTLROPQ-QWIYEXKTSA-N |
| SMILES | COc1cc(C2c3cc4c(cc3C(OC(C)=O)C3COC(=O)C23)OCO4)cc(OC)c1OC |
| Hazard Codes | Xi |
|---|
|
~%
Acetylepipodoph... CAS#:1180-35-4 |
| Literature: Hartwell; Schrecker Journal of the American Chemical Society, 1951 , vol. 73, p. 2909,2916 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ethynyl-magnesium bromide |
| Ethynylmagnesium bromide solution |
| O-Acetyl-epipodophyllotoxin |
| Furo[3',4':6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 9-(acetyloxy)-5,8,8a,9-tetrahydro-5-(3,4,5-trimethoxyphenyl)-, (5R,5aR,8aR,9S)- |
| acetylepipodophyllotoxin |
| ethynyl-MgBr |
| (5S,5aR,8aR,9R)-8-Oxo-9-(3,4,5-trimethoxyphenyl)-5,5a,6,8,8a,9-hexahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-5-yl acetate |
| acetylenemagnesium bromide |
| acetylenyl magnesium bromide |
| bromomagnesium acetylide |
| epipodophyllotoxin acetate |