4-(3-Methoxypropoxy)-2,3-dimethylpyridine-N-oxide structure
|
Common Name | 4-(3-Methoxypropoxy)-2,3-dimethylpyridine-N-oxide | ||
|---|---|---|---|---|
| CAS Number | 117977-18-1 | Molecular Weight | 211.25800 | |
| Density | 1.058 g/cm3 | Boiling Point | 387.448ºC at 760 mmHg | |
| Molecular Formula | C11H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-methoxypropoxy)-2,3-dimethyl-1-oxidopyridin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.058 g/cm3 |
|---|---|
| Boiling Point | 387.448ºC at 760 mmHg |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.25800 |
| Exact Mass | 211.12100 |
| PSA | 43.92000 |
| LogP | 2.14720 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.49 |
| InChIKey | NZQKWDSCDLYKDF-UHFFFAOYSA-N |
| SMILES | COCCCOc1cc[n+]([O-])c(C)c1C |
| Hazard Codes | Xn |
|---|
|
~96%
4-(3-Methoxypro... CAS#:117977-18-1 |
| Literature: IPCA LABORATORIES LIMITED Patent: WO2009/116072 A2, 2009 ; Location in patent: Page/Page column 12 ; |
|
~%
4-(3-Methoxypro... CAS#:117977-18-1 |
| Literature: Asian Journal of Chemistry, , vol. 25, # 14 p. 7959 - 7966 |
| 4-(3-Methoxypropoxy)-2,3-dimethylpyridine-N-oxide |
| Rabeprazole Impurity 5 |