Ethanedial,1,2-bis[2-(2,4-dinitrophenyl)hydrazone]
Modify Date: 2025-08-25 08:08:50
![Ethanedial,1,2-bis[2-(2,4-dinitrophenyl)hydrazone] Structure](https://image.chemsrc.com/caspic/281/1177-16-8.png)
Ethanedial,1,2-bis[2-(2,4-dinitrophenyl)hydrazone] structure
|
Common Name | Ethanedial,1,2-bis[2-(2,4-dinitrophenyl)hydrazone] | ||
|---|---|---|---|---|
| CAS Number | 1177-16-8 | Molecular Weight | 418.27800 | |
| Density | 1.73g/cm3 | Boiling Point | 615.8ºC at 760 mmHg | |
| Molecular Formula | C14H10N8O8 | Melting Point | >277°C (dec.) (lit.) | |
| MSDS | N/A | Flash Point | 326.2ºC | |
| Name | Acetaldehyde, hydroxy-, (2,4-dinitrophenyl)osazone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 615.8ºC at 760 mmHg |
| Melting Point | >277°C (dec.) (lit.) |
| Molecular Formula | C14H10N8O8 |
| Molecular Weight | 418.27800 |
| Flash Point | 326.2ºC |
| Exact Mass | 418.06200 |
| PSA | 232.06000 |
| LogP | 5.05380 |
| Vapour Pressure | 4.27E-15mmHg at 25°C |
| Index of Refraction | 1.736 |
| InChIKey | ZJFKDRQLHABQHQ-IAGONARPSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=CC=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| Storage condition | 2-8°C |
| Hazard Codes | F |
|---|---|
| HS Code | 2928000090 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Bis-<2,4-dinitro-phenylhydrazono>-glyoxal |
| Glyoxal-bis-(2,4-dinitro-phenylhydrazon) |
| Glyoxal bis[(2,4-dinitrophenyl)hydrazone] |