2-[2,6-di(propan-2-yl)phenyl]-5-methylimidazo[1,5-a]pyridin-4-ium,hexafluorophosphate
Modify Date: 2025-08-27 09:25:51
![2-[2,6-di(propan-2-yl)phenyl]-5-methylimidazo[1,5-a]pyridin-4-ium,hexafluorophosphate Structure](https://image.chemsrc.com/caspic/149/1176202-62-2.png)
2-[2,6-di(propan-2-yl)phenyl]-5-methylimidazo[1,5-a]pyridin-4-ium,hexafluorophosphate structure
|
Common Name | 2-[2,6-di(propan-2-yl)phenyl]-5-methylimidazo[1,5-a]pyridin-4-ium,hexafluorophosphate | ||
|---|---|---|---|---|
| CAS Number | 1176202-62-2 | Molecular Weight | 438.39000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H25F6N2P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-[2,6-di(propan-2-yl)phenyl]-5-methylimidazo[1,5-a]pyridin-4-ium,hexafluorophosphate |
|---|
| Molecular Formula | C20H25F6N2P |
|---|---|
| Molecular Weight | 438.39000 |
| Exact Mass | 438.16600 |
| PSA | 21.88000 |
| LogP | 8.15360 |
| InChIKey | QMSMRHHBCWKWQO-UHFFFAOYSA-N |
| SMILES | Cc1cccc2c[n+](-c3c(C(C)C)cccc3C(C)C)cn12.F[P-](F)(F)(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
|
Imidazo[1,5-a]pyridine: a versatile architecture for stable N-heterocyclic carbenes.
J. Am. Chem. Soc. 127 , 3290, (2005) The imidazo[1,5-a]pyridine skeleton provides a versatile platform for the generation of new types of stable N-heterocyclic carbenes. Rh(I) mono- (6) and biscarbenes (7) from imidazo[1,5-a]pyridin-3-yl... |