Artoheterophyllin B
Modify Date: 2025-09-30 12:37:32
Artoheterophyllin B structure
|
Common Name | Artoheterophyllin B | ||
|---|---|---|---|---|
| CAS Number | 1174017-37-8 | Molecular Weight | 504.571 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 740.9±60.0 °C at 760 mmHg | |
| Molecular Formula | C30H32O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.1±26.4 °C | |
Use of Artoheterophyllin BArtoheterophyllin B can be isolated from A. heterophyllus. Artoheterophyllin B shows antiplasmodial activity (IC50: 13.7 μM against FcB1 strain). Artoheterophyllin B can be used for anti-malarial research[1]. |
| Name | 2,3,8,10-Tetrahydroxy-9,11-bis(3-methyl-2-buten-1-yl)-6-(2-methyl -1-propen-1-yl)-6H,7H-chromeno[4,3-b]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Description | Artoheterophyllin B can be isolated from A. heterophyllus. Artoheterophyllin B shows antiplasmodial activity (IC50: 13.7 μM against FcB1 strain). Artoheterophyllin B can be used for anti-malarial research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 740.9±60.0 °C at 760 mmHg |
| Molecular Formula | C30H32O7 |
| Molecular Weight | 504.571 |
| Flash Point | 244.1±26.4 °C |
| Exact Mass | 504.214813 |
| PSA | 120.36000 |
| LogP | 7.40 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | MOPJKKUUKHCZPG-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2oc3c(c(=O)c2c1O)C(C=C(C)C)Oc1cc(O)c(O)cc1-3 |
| Hazard Codes | Xi |
|---|
| artoheterophyllin B |
| 2,3,8,10-Tetrahydroxy-9,11-bis(3-methyl-2-buten-1-yl)-6-(2-methyl-1-propen-1-yl)-6H,7H-chromeno[4,3-b]chromen-7-one |
| arthromerin B |
| Arthrobactin |
| 6H,7H-[1]Benzopyrano[3,2-c][1]benzopyran-7-one, 2,3,8,10-tetrahydroxy-9,11-bis(3-methyl-2-buten-1-yl)-6-(2-methyl-1-propen-1-yl)- |