VA-K-14 hydrochloride structure
|
Common Name | VA-K-14 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1171341-19-7 | Molecular Weight | 305.397 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 510.1±52.0 °C at 760 mmHg | |
| Molecular Formula | C18H16ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.3±30.7 °C | |
Use of VA-K-14 hydrochlorideVA-K-14 hydrochloride is a specific thyroid-stimulating hormone receptor (TSHR) antagonist (IC50= 12.3 μM)[1]. |
| Name | N-Methyl-4-(2-phenyl-1H-indol-3-yl)-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Description | VA-K-14 hydrochloride is a specific thyroid-stimulating hormone receptor (TSHR) antagonist (IC50= 12.3 μM)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 510.1±52.0 °C at 760 mmHg |
| Molecular Formula | C18H16ClN3S |
| Molecular Weight | 305.397 |
| Flash Point | 262.3±30.7 °C |
| Exact Mass | 305.098663 |
| LogP | 4.33 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.732 |
| InChIKey | MMEANJJDNROSBC-UHFFFAOYSA-N |
| SMILES | CNc1nc(-c2c(-c3ccccc3)[nH]c3ccccc23)cs1.Cl |
| MFCD10180795 |
| 2-Thiazolamine, N-methyl-4-(2-phenyl-1H-indol-3-yl)- |
| N-Methyl-4-(2-phenyl-1H-indol-3-yl)-1,3-thiazol-2-amine |