2-Amino-3-hydroxy-9,10-anthraquinone structure
|
Common Name | 2-Amino-3-hydroxy-9,10-anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 117-77-1 | Molecular Weight | 239.226 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 476.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.9±28.7 °C | |
| Name | 2-Amino-3-hydroxyanthraquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 476.4±45.0 °C at 760 mmHg |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.226 |
| Flash Point | 241.9±28.7 °C |
| Exact Mass | 239.058243 |
| PSA | 80.39000 |
| LogP | 2.98 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.745 |
| InChIKey | CNWWMJSRHGXXAX-UHFFFAOYSA-N |
| SMILES | Nc1cc2c(cc1O)C(=O)c1ccccc1C2=O |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2922509090 |
|
~%
2-Amino-3-hydro... CAS#:117-77-1 |
| Literature: DE456584 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 16, p. 1324 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Amino-3-hydroxyanthra-9,10-quinone |
| 2-Amino-3-hydroxy-9,10-anthraquinone |
| 2-amino-3-hydroxyanthracene-9,10-dione |
| MFCD00059499 |
| 9,10-Anthracenedione, 2-amino-3-hydroxy- |