manwuweizic acid
Modify Date: 2025-08-25 13:28:07
manwuweizic acid structure
|
Common Name | manwuweizic acid | ||
|---|---|---|---|---|
| CAS Number | 116963-87-2 | Molecular Weight | 470.68 | |
| Density | 1.05g/cm3 | Boiling Point | 569.9ºC at 760mmHg | |
| Molecular Formula | C30H46O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.4ºC | |
Use of manwuweizic acidManwuweizic acid is a triterpenoid that can be isolated from Kadsura heteroclite[1]. |
| Name | (Z,6R)-6-[(3R,3aR,6S,7S,9bR)-6-(3-methoxy-3-oxopropyl)-3a,9b-dimethyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,9-octahydro-1H-cyclopenta[a]naphthalen-3-yl]-2-methylhept-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Manwuweizic acid is a triterpenoid that can be isolated from Kadsura heteroclite[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 569.9ºC at 760mmHg |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.68 |
| Flash Point | 175.4ºC |
| Exact Mass | 470.34000 |
| PSA | 63.60000 |
| LogP | 7.50210 |
| Vapour Pressure | 1.77E-14mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | UPSFXEHDOPIMAJ-ISZOBLOUSA-N |
| SMILES | C=C(C)C1CCC2=C(CCC3(C)C(C(C)CCC=C(C)C(=O)O)CCC23C)C1CCC(=O)OC |
| Manwuweizic acid |